C17H29NO — CID 142903608
ethane;1-hydroxy-2,2,6,6-tetramethyl-4-phenylpiperidine (PubChem CID 142903608) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;1-hydroxy-2,2,6,6-tetramethyl-4-phenylpiperidine.
| Compound Name | ethane;1-hydroxy-2,2,6,6-tetramethyl-4-phenylpiperidine |
|---|---|
| PubChem CID | 142903608 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | ethane;1-hydroxy-2,2,6,6-tetramethyl-4-phenylpiperidine |
| SMILES | CC.CC1(C)CC(c2ccccc2)CC(C)(C)N1O |
| InChI | InChI=1S/C15H23NO.C2H6/c1-14(2)10-13(11-15(3,4)16(14)17)12-8-6-5-7-9-12;1-2/h5-9,13,17H,10-11H2,1-4H3;1-2H3 |
| InChIKey | NIYSDWMVQFHNFT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |