C40H24F10N4 — CID 142903708
(Z)-3-[4-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile (PubChem CID 142903708) has the molecular formula C40H24F10N4 and a molecular weight of 750.64 g/mol. Its IUPAC name is (Z)-3-[4-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 142903708 |
| Molecular Formula | C40H24F10N4 |
| Molecular Weight | 750.64 g/mol |
| Exact Mass | 750.18 |
| IUPAC Name | (Z)-3-[4-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
| SMILES | CN(C)c1ccc(-c2cc(/C=C(\C#N)c3c(F)c(F)c(F)c(F)c3F)c(-c3ccc(N(C)C)cc3)cc2/C=C(\C#N)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C40H24F10N4/c1-53(2)25-9-5-19(6-10-25)27-15-22(14-24(18-52)30-33(43)37(47)40(50)38(48)34(30)44)28(20-7-11-26(12-8-20)54(3)4)16-21(27)13-23(17-51)29-31(41)35(45)39(49)36(46)32(29)42/h5-16H,1-4H3/b23-13+,24-14+ |
| InChIKey | MLPGMUYEKORBFH-RNIAWFEPSA-N |
| XLogP | 10.67 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.64 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|