C26H30N4O — CID 142904185
(2Z,4Z)-1-N-benzyl-2-ethyl-6-methoxy-3-N-(2-phenylpyrazol-3-yl)hepta-2,4,6-triene-1,3-diamine (PubChem CID 142904185) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is (2Z,4Z)-1-N-benzyl-2-ethyl-6-methoxy-3-N-(2-phenylpyrazol-3-yl)hepta-2,4,6-triene-1,3-diamine.
| Compound Name | (2Z,4Z)-1-N-benzyl-2-ethyl-6-methoxy-3-N-(2-phenylpyrazol-3-yl)hepta-2,4,6-triene-1,3-diamine |
|---|---|
| PubChem CID | 142904185 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2Z,4Z)-1-N-benzyl-2-ethyl-6-methoxy-3-N-(2-phenylpyrazol-3-yl)hepta-2,4,6-triene-1,3-diamine |
| SMILES | C=C(/C=C\C(Nc1ccnn1-c1ccccc1)=C(/CC)CNCc1ccccc1)OC |
| InChI | InChI=1S/C26H30N4O/c1-4-23(20-27-19-22-11-7-5-8-12-22)25(16-15-21(2)31-3)29-26-17-18-28-30(26)24-13-9-6-10-14-24/h5-18,27,29H,2,4,19-20H2,1,3H3/b16-15-,25-23- |
| InChIKey | HRFLFPYZVFPKBO-HVMSPCFISA-N |
| XLogP | 5.45 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|