C10H14F2O — CID 142904545
(4Z,6Z)-3-(difluoromethoxy)-5-methylocta-1,4,6-triene (PubChem CID 142904545) has the molecular formula C10H14F2O and a molecular weight of 188.22 g/mol. Its IUPAC name is (4Z,6Z)-3-(difluoromethoxy)-5-methylocta-1,4,6-triene.
| Compound Name | (4Z,6Z)-3-(difluoromethoxy)-5-methylocta-1,4,6-triene |
|---|---|
| PubChem CID | 142904545 |
| Molecular Formula | C10H14F2O |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (4Z,6Z)-3-(difluoromethoxy)-5-methylocta-1,4,6-triene |
| SMILES | C=CC(/C=C(C)\C=C/C)OC(F)F |
| InChI | InChI=1S/C10H14F2O/c1-4-6-8(3)7-9(5-2)13-10(11)12/h4-7,9-10H,2H2,1,3H3/b6-4-,8-7- |
| InChIKey | OVGRKGAKZYKNHW-MOIRPGTBSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|