C27H41N3O — CID 142905017
4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine;3-[1-[[(E)-but-2-en-2-yl]amino]butyl]aniline (PubChem CID 142905017) has the molecular formula C27H41N3O and a molecular weight of 423.65 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine;3-[1-[[(E)-but-2-en-2-yl]amino]butyl]aniline.
| Compound Name | 4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine;3-[1-[[(E)-but-2-en-2-yl]amino]butyl]aniline |
|---|---|
| PubChem CID | 142905017 |
| Molecular Formula | C27H41N3O |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine;3-[1-[[(E)-but-2-en-2-yl]amino]butyl]aniline |
| SMILES | C/C=C(\C)NC(CCC)c1cccc(N)c1.C=CC(=C)C1(C)C=C(OC)C(NC)=CC1 |
| InChI | InChI=1S/C14H22N2.C13H19NO/c1-4-7-14(16-11(3)5-2)12-8-6-9-13(15)10-12;1-6-10(2)13(3)8-7-11(14-4)12(9-13)15-5/h5-6,8-10,14,16H,4,7,15H2,1-3H3;6-7,9,14H,1-2,8H2,3-5H3/b11-5+; |
| InChIKey | YOMWIHIKZWKOAO-HMXKFKBXSA-N |
| XLogP | 6.40 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|