C13H19NO — CID 142905018
4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine (PubChem CID 142905018) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine.
| Compound Name | 4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 142905018 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-6-methoxy-N,4-dimethylcyclohexa-1,5-dien-1-amine |
| SMILES | C=CC(=C)C1(C)C=C(OC)C(NC)=CC1 |
| InChI | InChI=1S/C13H19NO/c1-6-10(2)13(3)8-7-11(14-4)12(9-13)15-5/h6-7,9,14H,1-2,8H2,3-5H3 |
| InChIKey | JXFKMZHWJLMOBH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|