C19H27FN2S — CID 142905098
N-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]-N,N',2-trimethylpentane-1,5-diamine (PubChem CID 142905098) has the molecular formula C19H27FN2S and a molecular weight of 334.50 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]-N,N',2-trimethylpentane-1,5-diamine.
| Compound Name | N-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]-N,N',2-trimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 142905098 |
| Molecular Formula | C19H27FN2S |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]-N,N',2-trimethylpentane-1,5-diamine |
| SMILES | CNCCCC(C)CN(C)c1cc(-c2ccc(F)cc2)sc1C |
| InChI | InChI=1S/C19H27FN2S/c1-14(6-5-11-21-3)13-22(4)18-12-19(23-15(18)2)16-7-9-17(20)10-8-16/h7-10,12,14,21H,5-6,11,13H2,1-4H3 |
| InChIKey | DACIPEPXVIBVMW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|