About ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile
ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile (PubChem CID 142905900) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile.
Molecular Properties
| Compound Name | ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile |
| PubChem CID | 142905900 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile |
| SMILES | C=C(/C=C/C)C[C@@H](O)CC#N.CC.CC |
| InChI | InChI=1S/C9H13NO.2C2H6/c1-3-4-8(2)7-9(11)5-6-10;2*1-2/h3-4,9,11H,2,5,7H2,1H3;2*1-2H3/b4-3+;;/t9-;;/m0../s1 |
| InChIKey | UJLUDQSAWSPAIO-GWNGFIPOSA-N |
| XLogP | 3.84 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile?
The IUPAC name of ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile (CID 142905900) is ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile.
What is the SMILES notation for ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile?
The canonical SMILES for ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile is C=C(/C=C/C)C[C@@H](O)CC#N.CC.CC.
What is the InChIKey of ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile?
The InChIKey is UJLUDQSAWSPAIO-GWNGFIPOSA-N. The full InChI is InChI=1S/C9H13NO.2C2H6/c1-3-4-8(2)7-9(11)5-6-10;2*1-2/h3-4,9,11H,2,5,7H2,1H3;2*1-2H3/b4-3+;;/t9-;;/m0../s1.
What are the key properties of ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile?
ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile has a molecular weight of 211.35 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E,3R)-3-hydroxy-5-methylideneoct-6-enenitrile is sourced from PubChem (CID 142905900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).