About (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol
(2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol (PubChem CID 14290619) has the molecular formula C9H18OSi
and a molecular weight of 170.33 g/mol. Its IUPAC name is (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol.
Molecular Properties
| Compound Name | (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol |
| PubChem CID | 14290619 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol |
| SMILES | C[Si](C)(C)/C=C/C/C=C/CO |
| InChI | InChI=1S/C9H18OSi/c1-11(2,3)9-7-5-4-6-8-10/h4,6-7,9-10H,5,8H2,1-3H3/b6-4+,9-7+ |
| InChIKey | YETSPCCPUYLWIC-ADIUVMHLSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol?
The IUPAC name of (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol (CID 14290619) is (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol.
What is the SMILES notation for (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol?
The canonical SMILES for (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol is C[Si](C)(C)/C=C/C/C=C/CO.
What is the InChIKey of (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol?
The InChIKey is YETSPCCPUYLWIC-ADIUVMHLSA-N. The full InChI is InChI=1S/C9H18OSi/c1-11(2,3)9-7-5-4-6-8-10/h4,6-7,9-10H,5,8H2,1-3H3/b6-4+,9-7+.
What are the key properties of (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol?
(2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol has a molecular weight of 170.33 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,5E)-6-trimethylsilylhexa-2,5-dien-1-ol is sourced from PubChem (CID 14290619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).