C24H22N2O — CID 142906481
[2-[(Z)-2-tricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,15-hexaenylidenemethyl]phenyl]urea (PubChem CID 142906481) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is [2-[(Z)-2-tricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,15-hexaenylidenemethyl]phenyl]urea.
| Compound Name | [2-[(Z)-2-tricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,15-hexaenylidenemethyl]phenyl]urea |
|---|---|
| PubChem CID | 142906481 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | [2-[(Z)-2-tricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,12,15-hexaenylidenemethyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccccc1/C=C1/C2=C(C=CCC=C2)CCc2ccccc21 |
| InChI | InChI=1S/C24H22N2O/c25-24(27)26-23-13-7-5-10-19(23)16-22-20-11-3-1-2-8-17(20)14-15-18-9-4-6-12-21(18)22/h2-13,16H,1,14-15H2,(H3,25,26,27)/b22-16- |
| InChIKey | OSOCWLXDWPNJDC-JWGURIENSA-N |
| XLogP | 5.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|