C17H30N2S — CID 142906918
(3E,5Z)-8-[2-methylpropyl(piperidin-4-yl)amino]octa-1,3,5-triene-4-thiol (PubChem CID 142906918) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is (3E,5Z)-8-[2-methylpropyl(piperidin-4-yl)amino]octa-1,3,5-triene-4-thiol.
| Compound Name | (3E,5Z)-8-[2-methylpropyl(piperidin-4-yl)amino]octa-1,3,5-triene-4-thiol |
|---|---|
| PubChem CID | 142906918 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (3E,5Z)-8-[2-methylpropyl(piperidin-4-yl)amino]octa-1,3,5-triene-4-thiol |
| SMILES | C=C/C=C(S)\C=C/CCN(CC(C)C)C1CCNCC1 |
| InChI | InChI=1S/C17H30N2S/c1-4-7-17(20)8-5-6-13-19(14-15(2)3)16-9-11-18-12-10-16/h4-5,7-8,15-16,18,20H,1,6,9-14H2,2-3H3/b8-5-,17-7+ |
| InChIKey | URQPFHNOHXFCPK-YZNYGJBQSA-N |
| XLogP | 3.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|