C20H34ClF3N2 — CID 142906960
(Z)-but-2-ene;N-[(Z)-3-chloro-5,5,5-trifluoro-4-methyl-2-methylidenepent-3-enyl]-N-(2-methylpropyl)piperidin-4-amine (PubChem CID 142906960) has the molecular formula C20H34ClF3N2 and a molecular weight of 394.95 g/mol. Its IUPAC name is (Z)-but-2-ene;N-[(Z)-3-chloro-5,5,5-trifluoro-4-methyl-2-methylidenepent-3-enyl]-N-(2-methylpropyl)piperidin-4-amine.
| Compound Name | (Z)-but-2-ene;N-[(Z)-3-chloro-5,5,5-trifluoro-4-methyl-2-methylidenepent-3-enyl]-N-(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 142906960 |
| Molecular Formula | C20H34ClF3N2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (Z)-but-2-ene;N-[(Z)-3-chloro-5,5,5-trifluoro-4-methyl-2-methylidenepent-3-enyl]-N-(2-methylpropyl)piperidin-4-amine |
| SMILES | C/C=C\C.C=C(CN(CC(C)C)C1CCNCC1)/C(Cl)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C16H26ClF3N2.C4H8/c1-11(2)9-22(14-5-7-21-8-6-14)10-12(3)15(17)13(4)16(18,19)20;1-3-4-2/h11,14,21H,3,5-10H2,1-2,4H3;3-4H,1-2H3/b15-13-;4-3- |
| InChIKey | DEPBXCZSLJNJLO-KEFVONFDSA-N |
| XLogP | 5.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|