About (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane
(E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane (PubChem CID 142907203) has the molecular formula C11H11N3O3
and a molecular weight of 233.23 g/mol. Its IUPAC name is (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane.
Molecular Properties
| Compound Name | (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane |
| PubChem CID | 142907203 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane |
| SMILES | C.O=C/C=C/c1cnc2[nH]c(=O)[nH]c(=O)c2c1 |
| InChI | InChI=1S/C10H7N3O3.CH4/c14-3-1-2-6-4-7-8(11-5-6)12-10(16)13-9(7)15;/h1-5H,(H2,11,12,13,15,16);1H4/b2-1+; |
| InChIKey | RUIDDCIXDWKWAI-TYYBGVCCSA-N |
| XLogP | 0.46 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane?
The IUPAC name of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane (CID 142907203) is (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane.
What is the SMILES notation for (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane?
The canonical SMILES for (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane is C.O=C/C=C/c1cnc2[nH]c(=O)[nH]c(=O)c2c1.
What is the InChIKey of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane?
The InChIKey is RUIDDCIXDWKWAI-TYYBGVCCSA-N. The full InChI is InChI=1S/C10H7N3O3.CH4/c14-3-1-2-6-4-7-8(11-5-6)12-10(16)13-9(7)15;/h1-5H,(H2,11,12,13,15,16);1H4/b2-1+;.
What are the key properties of (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane?
(E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane has a molecular weight of 233.23 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2,4-dioxo-1H-pyrido[2,3-d]pyrimidin-6-yl)prop-2-enal;methane is sourced from PubChem (CID 142907203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).