About methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate
methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate (PubChem CID 142907459) has the molecular formula C9H9NO5
and a molecular weight of 211.17 g/mol. Its IUPAC name is methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate |
| PubChem CID | 142907459 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)C1=CC=C2NC(=O)OC21CO |
| InChI | InChI=1S/C9H9NO5/c1-14-7(12)5-2-3-6-9(5,4-11)15-8(13)10-6/h2-3,11H,4H2,1H3,(H,10,13) |
| InChIKey | WKWGXHXZVYWHJM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate?
The IUPAC name of methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate (CID 142907459) is methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate.
What is the SMILES notation for methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate?
The canonical SMILES for methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate is COC(=O)C1=CC=C2NC(=O)OC21CO.
What is the InChIKey of methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate?
The InChIKey is WKWGXHXZVYWHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO5/c1-14-7(12)5-2-3-6-9(5,4-11)15-8(13)10-6/h2-3,11H,4H2,1H3,(H,10,13).
What are the key properties of methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate?
methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate has a molecular weight of 211.17 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6a-(hydroxymethyl)-2-oxo-3H-cyclopenta[d][1,3]oxazole-6-carboxylate is sourced from PubChem (CID 142907459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).