C22H33N3O — CID 142907701
[(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate (PubChem CID 142907701) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is [(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate.
| Compound Name | [(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate |
|---|---|
| PubChem CID | 142907701 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | [(E)-[(2E,3Z,6E,11Z)-2-ethylidene-6-methyltrideca-3,6,8,11-tetraenylidene]amino] piperidine-4-carboximidate |
| SMILES | [H]/N=C(\O/N=C/C(/C=C\C/C(C)=C/C=CC/C=C\C)=C/C)C1CCNCC1 |
| InChI | InChI=1S/C22H33N3O/c1-4-6-7-8-9-11-19(3)12-10-13-20(5-2)18-25-26-22(23)21-14-16-24-17-15-21/h4-6,8-11,13,18,21,23-24H,7,12,14-17H2,1-3H3/b6-4-,9-8?,13-10-,19-11+,20-5+,23-22-,25-18+ |
| InChIKey | SOBOMILGRSVCIW-GADXFUPRSA-N |
| XLogP | 5.33 |
| TPSA | 57.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|