About ethyl 4H-azepine-6-carboxylate
ethyl 4H-azepine-6-carboxylate (PubChem CID 142907848) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is ethyl 4H-azepine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 4H-azepine-6-carboxylate |
| PubChem CID | 142907848 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | ethyl 4H-azepine-6-carboxylate |
| SMILES | CCOC(=O)C1=CCC=CN=C1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)8-5-3-4-6-10-7-8/h4-7H,2-3H2,1H3 |
| InChIKey | XGOGVTTUZRQVOX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4H-azepine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4H-azepine-6-carboxylate?
The IUPAC name of ethyl 4H-azepine-6-carboxylate (CID 142907848) is ethyl 4H-azepine-6-carboxylate.
What is the SMILES notation for ethyl 4H-azepine-6-carboxylate?
The canonical SMILES for ethyl 4H-azepine-6-carboxylate is CCOC(=O)C1=CCC=CN=C1.
What is the InChIKey of ethyl 4H-azepine-6-carboxylate?
The InChIKey is XGOGVTTUZRQVOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-12-9(11)8-5-3-4-6-10-7-8/h4-7H,2-3H2,1H3.
What are the key properties of ethyl 4H-azepine-6-carboxylate?
ethyl 4H-azepine-6-carboxylate has a molecular weight of 165.19 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4H-azepine-6-carboxylate is sourced from PubChem (CID 142907848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).