About ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol
ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol (PubChem CID 142907962) has the molecular formula C19H39BrO4
and a molecular weight of 411.42 g/mol. Its IUPAC name is ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol.
Molecular Properties
| Compound Name | ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol |
| PubChem CID | 142907962 |
| Molecular Formula | C19H39BrO4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol |
| SMILES | C.CC(C)C[C@@H]1COC(O)C1.CCOC(=O)C[C@@H](CBr)CC(C)C |
| InChI | InChI=1S/C10H19BrO2.C8H16O2.CH4/c1-4-13-10(12)6-9(7-11)5-8(2)3;1-6(2)3-7-4-8(9)10-5-7;/h8-9H,4-7H2,1-3H3;6-9H,3-5H2,1-2H3;1H4/t9-;7-,8?;/m00./s1 |
| InChIKey | NKLOSJRSTRHQJU-BBGKWDRLSA-N |
| XLogP | 5.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol?
The IUPAC name of ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol (CID 142907962) is ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol.
What is the SMILES notation for ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol?
The canonical SMILES for ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol is C.CC(C)C[C@@H]1COC(O)C1.CCOC(=O)C[C@@H](CBr)CC(C)C.
What is the InChIKey of ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol?
The InChIKey is NKLOSJRSTRHQJU-BBGKWDRLSA-N. The full InChI is InChI=1S/C10H19BrO2.C8H16O2.CH4/c1-4-13-10(12)6-9(7-11)5-8(2)3;1-6(2)3-7-4-8(9)10-5-7;/h8-9H,4-7H2,1-3H3;6-9H,3-5H2,1-2H3;1H4/t9-;7-,8?;/m00./s1.
What are the key properties of ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol?
ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol has a molecular weight of 411.42 g/mol, XLogP of 5.02, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-3-(bromomethyl)-5-methylhexanoate;methane;(4S)-4-(2-methylpropyl)oxolan-2-ol is sourced from PubChem (CID 142907962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).