C13H20ClNO3 — CID 142907984
3-(3-chlorophenoxy)butan-1-amine;propanoic acid (PubChem CID 142907984) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)butan-1-amine;propanoic acid.
| Compound Name | 3-(3-chlorophenoxy)butan-1-amine;propanoic acid |
|---|---|
| PubChem CID | 142907984 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-(3-chlorophenoxy)butan-1-amine;propanoic acid |
| SMILES | CC(CCN)Oc1cccc(Cl)c1.CCC(=O)O |
| InChI | InChI=1S/C10H14ClNO.C3H6O2/c1-8(5-6-12)13-10-4-2-3-9(11)7-10;1-2-3(4)5/h2-4,7-8H,5-6,12H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | QATMRWLKQSGIHR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |