C16H24N2O — CID 142908284
(2Z,4Z,5Z)-4-ethylidene-5,6-dimethyl-2-(methylamino)-N-prop-1-en-2-ylocta-2,5,7-trienamide (PubChem CID 142908284) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (2Z,4Z,5Z)-4-ethylidene-5,6-dimethyl-2-(methylamino)-N-prop-1-en-2-ylocta-2,5,7-trienamide.
| Compound Name | (2Z,4Z,5Z)-4-ethylidene-5,6-dimethyl-2-(methylamino)-N-prop-1-en-2-ylocta-2,5,7-trienamide |
|---|---|
| PubChem CID | 142908284 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (2Z,4Z,5Z)-4-ethylidene-5,6-dimethyl-2-(methylamino)-N-prop-1-en-2-ylocta-2,5,7-trienamide |
| SMILES | C=C/C(C)=C(C)\C(/C=C(\NC)C(=O)NC(=C)C)=C/C |
| InChI | InChI=1S/C16H24N2O/c1-8-12(5)13(6)14(9-2)10-15(17-7)16(19)18-11(3)4/h8-10,17H,1,3H2,2,4-7H3,(H,18,19)/b13-12-,14-9-,15-10- |
| InChIKey | DXWMCMJCRHWKTO-ANQVQQBYSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|