C18H21N3O — CID 142908581
4-(4-methoxyphenyl)-3-(methyliminomethyl)-5,6,7,8-tetrahydroquinolin-2-amine (PubChem CID 142908581) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3-(methyliminomethyl)-5,6,7,8-tetrahydroquinolin-2-amine.
| Compound Name | 4-(4-methoxyphenyl)-3-(methyliminomethyl)-5,6,7,8-tetrahydroquinolin-2-amine |
|---|---|
| PubChem CID | 142908581 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 4-(4-methoxyphenyl)-3-(methyliminomethyl)-5,6,7,8-tetrahydroquinolin-2-amine |
| SMILES | C/N=C/c1c(N)nc2c(c1-c1ccc(OC)cc1)CCCC2 |
| InChI | InChI=1S/C18H21N3O/c1-20-11-15-17(12-7-9-13(22-2)10-8-12)14-5-3-4-6-16(14)21-18(15)19/h7-11H,3-6H2,1-2H3,(H2,19,21)/b20-11+ |
| InChIKey | XLWOGAPBEMMQLU-RGVLZGJSSA-N |
| XLogP | 3.27 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|