C25H21F6N5O2 — CID 142908861
(2-methoxyethylamino)-[4-[4-(trifluoromethyl)anilino]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-2-yl]methanol (PubChem CID 142908861) has the molecular formula C25H21F6N5O2 and a molecular weight of 537.46 g/mol. Its IUPAC name is (2-methoxyethylamino)-[4-[4-(trifluoromethyl)anilino]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-2-yl]methanol.
| Compound Name | (2-methoxyethylamino)-[4-[4-(trifluoromethyl)anilino]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-2-yl]methanol |
|---|---|
| PubChem CID | 142908861 |
| Molecular Formula | C25H21F6N5O2 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | (2-methoxyethylamino)-[4-[4-(trifluoromethyl)anilino]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-2-yl]methanol |
| SMILES | COCCNC(O)c1nc(Nc2ccc(C(F)(F)F)cc2)c2ccc(-c3ncccc3C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C25H21F6N5O2/c1-38-12-11-33-23(37)22-35-19-13-14(20-18(25(29,30)31)3-2-10-32-20)4-9-17(19)21(36-22)34-16-7-5-15(6-8-16)24(26,27)28/h2-10,13,23,33,37H,11-12H2,1H3,(H,34,35,36) |
| InChIKey | TXJUAKRSIOFEMY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|