C20H40N4 — CID 142909505
ethane;N'-[ethyl(methyl)amino]-N-methylidenepiperidine-4-carboximidamide;(2Z,4Z)-octa-2,4-diene (PubChem CID 142909505) has the molecular formula C20H40N4 and a molecular weight of 336.57 g/mol. Its IUPAC name is ethane;N'-[ethyl(methyl)amino]-N-methylidenepiperidine-4-carboximidamide;(2Z,4Z)-octa-2,4-diene.
| Compound Name | ethane;N'-[ethyl(methyl)amino]-N-methylidenepiperidine-4-carboximidamide;(2Z,4Z)-octa-2,4-diene |
|---|---|
| PubChem CID | 142909505 |
| Molecular Formula | C20H40N4 |
| Molecular Weight | 336.57 g/mol |
| Exact Mass | 336.33 |
| IUPAC Name | ethane;N'-[ethyl(methyl)amino]-N-methylidenepiperidine-4-carboximidamide;(2Z,4Z)-octa-2,4-diene |
| SMILES | C/C=C\C=C/CCC.C=N/C(=N\N(C)CC)C1CCNCC1.CC |
| InChI | InChI=1S/C10H20N4.C8H14.C2H6/c1-4-14(3)13-10(11-2)9-5-7-12-8-6-9;1-3-5-7-8-6-4-2;1-2/h9,12H,2,4-8H2,1,3H3;3,5,7-8H,4,6H2,1-2H3;1-2H3/b13-10-;5-3-,8-7-; |
| InChIKey | ZPUNHOYMQLKXTF-LXOZKVKZSA-N |
| XLogP | 4.90 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|