About 4-acetyl-1,4-dihydrotriazol-5-one;ethane
4-acetyl-1,4-dihydrotriazol-5-one;ethane (PubChem CID 142909787) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 4-acetyl-1,4-dihydrotriazol-5-one;ethane.
Molecular Properties
| Compound Name | 4-acetyl-1,4-dihydrotriazol-5-one;ethane |
| PubChem CID | 142909787 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 4-acetyl-1,4-dihydrotriazol-5-one;ethane |
| SMILES | CC.CC(=O)C1N=NNC1=O |
| InChI | InChI=1S/C4H5N3O2.C2H6/c1-2(8)3-4(9)6-7-5-3;1-2/h3H,1H3,(H,5,6,9);1-2H3 |
| InChIKey | TWTXEXNKRQRWFS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-acetyl-1,4-dihydrotriazol-5-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-1,4-dihydrotriazol-5-one;ethane?
The IUPAC name of 4-acetyl-1,4-dihydrotriazol-5-one;ethane (CID 142909787) is 4-acetyl-1,4-dihydrotriazol-5-one;ethane.
What is the SMILES notation for 4-acetyl-1,4-dihydrotriazol-5-one;ethane?
The canonical SMILES for 4-acetyl-1,4-dihydrotriazol-5-one;ethane is CC.CC(=O)C1N=NNC1=O.
What is the InChIKey of 4-acetyl-1,4-dihydrotriazol-5-one;ethane?
The InChIKey is TWTXEXNKRQRWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2.C2H6/c1-2(8)3-4(9)6-7-5-3;1-2/h3H,1H3,(H,5,6,9);1-2H3.
What are the key properties of 4-acetyl-1,4-dihydrotriazol-5-one;ethane?
4-acetyl-1,4-dihydrotriazol-5-one;ethane has a molecular weight of 157.17 g/mol, XLogP of 0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-1,4-dihydrotriazol-5-one;ethane is sourced from PubChem (CID 142909787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).