About but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene
but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene (PubChem CID 142909849) has the molecular formula C19H36N4
and a molecular weight of 320.53 g/mol. Its IUPAC name is but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene.
Molecular Properties
| Compound Name | but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene |
| PubChem CID | 142909849 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene |
| SMILES | C=CC(=C)CC.C=CCC.CC/N=C/N=C(\N)C1CCNCC1 |
| InChI | InChI=1S/C9H18N4.C6H10.C4H8/c1-2-11-7-13-9(10)8-3-5-12-6-4-8;1-4-6(3)5-2;1-3-4-2/h7-8,12H,2-6H2,1H3,(H2,10,11,13);4H,1,3,5H2,2H3;3H,1,4H2,2H3 |
| InChIKey | VDGZZAVQQHLCAA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene?
The IUPAC name of but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene (CID 142909849) is but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene.
What is the SMILES notation for but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene?
The canonical SMILES for but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene is C=CC(=C)CC.C=CCC.CC/N=C/N=C(\N)C1CCNCC1.
What is the InChIKey of but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene?
The InChIKey is VDGZZAVQQHLCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4.C6H10.C4H8/c1-2-11-7-13-9(10)8-3-5-12-6-4-8;1-4-6(3)5-2;1-3-4-2/h7-8,12H,2-6H2,1H3,(H2,10,11,13);4H,1,3,5H2,2H3;3H,1,4H2,2H3.
What are the key properties of but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene?
but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene has a molecular weight of 320.53 g/mol, XLogP of 4.11, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;N'-(ethyliminomethyl)piperidine-4-carboximidamide;3-methylidenepent-1-ene is sourced from PubChem (CID 142909849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).