C19H34N2O4S — CID 142910553
ethane;2-(4-methylsulfonylphenyl)-N-piperidin-4-yl-N-propylacetamide;hydrate (PubChem CID 142910553) has the molecular formula C19H34N2O4S and a molecular weight of 386.56 g/mol. Its IUPAC name is ethane;2-(4-methylsulfonylphenyl)-N-piperidin-4-yl-N-propylacetamide;hydrate.
| Compound Name | ethane;2-(4-methylsulfonylphenyl)-N-piperidin-4-yl-N-propylacetamide;hydrate |
|---|---|
| PubChem CID | 142910553 |
| Molecular Formula | C19H34N2O4S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | ethane;2-(4-methylsulfonylphenyl)-N-piperidin-4-yl-N-propylacetamide;hydrate |
| SMILES | CC.CCCN(C(=O)Cc1ccc(S(C)(=O)=O)cc1)C1CCNCC1.O |
| InChI | InChI=1S/C17H26N2O3S.C2H6.H2O/c1-3-12-19(15-8-10-18-11-9-15)17(20)13-14-4-6-16(7-5-14)23(2,21)22;1-2;/h4-7,15,18H,3,8-13H2,1-2H3;1-2H3;1H2 |
| InChIKey | DGONAYQJMJGKIP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |