About N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide
N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide (PubChem CID 142910634) has the molecular formula C17H26N4
and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide.
Molecular Properties
| Compound Name | N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide |
| PubChem CID | 142910634 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide |
| SMILES | CCC(/N=C(\N)CC12C=CC=CC1C2)=N\C1CCNCC1 |
| InChI | InChI=1S/C17H26N4/c1-2-16(20-14-6-9-19-10-7-14)21-15(18)12-17-8-4-3-5-13(17)11-17/h3-5,8,13-14,19H,2,6-7,9-12H2,1H3,(H2,18,20,21) |
| InChIKey | XHFUDCIFZGIEHU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide?
The IUPAC name of N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide (CID 142910634) is N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide.
What is the SMILES notation for N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide?
The canonical SMILES for N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide is CCC(/N=C(\N)CC12C=CC=CC1C2)=N\C1CCNCC1.
What is the InChIKey of N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide?
The InChIKey is XHFUDCIFZGIEHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4/c1-2-16(20-14-6-9-19-10-7-14)21-15(18)12-17-8-4-3-5-13(17)11-17/h3-5,8,13-14,19H,2,6-7,9-12H2,1H3,(H2,18,20,21).
What are the key properties of N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide?
N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide has a molecular weight of 286.42 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-amino-2-(1-bicyclo[4.1.0]hepta-2,4-dienyl)ethylidene]-N'-piperidin-4-ylpropanimidamide is sourced from PubChem (CID 142910634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).