C29H32ClN3O3 — CID 142910972
3-[[4-[[(2-amino-5-cyclohexylphenyl)-(4-chlorophenyl)methyl]amino]benzoyl]amino]propanoic acid (PubChem CID 142910972) has the molecular formula C29H32ClN3O3 and a molecular weight of 506.05 g/mol. Its IUPAC name is 3-[[4-[[(2-amino-5-cyclohexylphenyl)-(4-chlorophenyl)methyl]amino]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[(2-amino-5-cyclohexylphenyl)-(4-chlorophenyl)methyl]amino]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 142910972 |
| Molecular Formula | C29H32ClN3O3 |
| Molecular Weight | 506.05 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 3-[[4-[[(2-amino-5-cyclohexylphenyl)-(4-chlorophenyl)methyl]amino]benzoyl]amino]propanoic acid |
| SMILES | Nc1ccc(C2CCCCC2)cc1C(Nc1ccc(C(=O)NCCC(=O)O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H32ClN3O3/c30-23-11-6-20(7-12-23)28(25-18-22(10-15-26(25)31)19-4-2-1-3-5-19)33-24-13-8-21(9-14-24)29(36)32-17-16-27(34)35/h6-15,18-19,28,33H,1-5,16-17,31H2,(H,32,36)(H,34,35) |
| InChIKey | RKANAQIOWVUPJH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.05 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|