C20H20BrNO4S — CID 142911285
5-[[3-bromo-4-(5-hydroxyhex-5-enoxy)naphthalen-1-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 142911285) has the molecular formula C20H20BrNO4S and a molecular weight of 450.35 g/mol. Its IUPAC name is 5-[[3-bromo-4-(5-hydroxyhex-5-enoxy)naphthalen-1-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-bromo-4-(5-hydroxyhex-5-enoxy)naphthalen-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 142911285 |
| Molecular Formula | C20H20BrNO4S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | 5-[[3-bromo-4-(5-hydroxyhex-5-enoxy)naphthalen-1-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C=C(O)CCCCOc1c(Br)cc(CC2SC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C20H20BrNO4S/c1-12(23)6-4-5-9-26-18-15-8-3-2-7-14(15)13(10-16(18)21)11-17-19(24)22-20(25)27-17/h2-3,7-8,10,17,23H,1,4-6,9,11H2,(H,22,24,25) |
| InChIKey | ZQBONUUKMDRUHO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|