C29H30ClN5O2 — CID 142911617
3-amino-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-4-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]benzamide (PubChem CID 142911617) has the molecular formula C29H30ClN5O2 and a molecular weight of 516.05 g/mol. Its IUPAC name is 3-amino-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-4-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]benzamide.
| Compound Name | 3-amino-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-4-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 142911617 |
| Molecular Formula | C29H30ClN5O2 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 3-amino-N-[1-(6-chloro-1H-benzimidazol-2-yl)ethyl]-4-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(C(=O)N2CCCC2CCc2ccccc2)c(N)c1)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C29H30ClN5O2/c1-18(27-33-25-14-11-21(30)17-26(25)34-27)32-28(36)20-10-13-23(24(31)16-20)29(37)35-15-5-8-22(35)12-9-19-6-3-2-4-7-19/h2-4,6-7,10-11,13-14,16-18,22H,5,8-9,12,15,31H2,1H3,(H,32,36)(H,33,34) |
| InChIKey | JJSPSJUQTUKBOI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|