C32H47ClN4O4 — CID 142911643
but-1-ene;tert-butyl N-[2-[(2R)-1-[2-chloro-4-(methylcarbamoyl)benzoyl]pyrrolidin-2-yl]ethyl]carbamate;2,4-dimethylaniline (PubChem CID 142911643) has the molecular formula C32H47ClN4O4 and a molecular weight of 587.21 g/mol. Its IUPAC name is but-1-ene;tert-butyl N-[2-[(2R)-1-[2-chloro-4-(methylcarbamoyl)benzoyl]pyrrolidin-2-yl]ethyl]carbamate;2,4-dimethylaniline.
| Compound Name | but-1-ene;tert-butyl N-[2-[(2R)-1-[2-chloro-4-(methylcarbamoyl)benzoyl]pyrrolidin-2-yl]ethyl]carbamate;2,4-dimethylaniline |
|---|---|
| PubChem CID | 142911643 |
| Molecular Formula | C32H47ClN4O4 |
| Molecular Weight | 587.21 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | but-1-ene;tert-butyl N-[2-[(2R)-1-[2-chloro-4-(methylcarbamoyl)benzoyl]pyrrolidin-2-yl]ethyl]carbamate;2,4-dimethylaniline |
| SMILES | C=CCC.CNC(=O)c1ccc(C(=O)N2CCC[C@@H]2CCNC(=O)OC(C)(C)C)c(Cl)c1.Cc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C20H28ClN3O4.C8H11N.C4H8/c1-20(2,3)28-19(27)23-10-9-14-6-5-11-24(14)18(26)15-8-7-13(12-16(15)21)17(25)22-4;1-6-3-4-8(9)7(2)5-6;1-3-4-2/h7-8,12,14H,5-6,9-11H2,1-4H3,(H,22,25)(H,23,27);3-5H,9H2,1-2H3;3H,1,4H2,2H3/t14-;;/m1../s1 |
| InChIKey | OARAIAGWJCHADP-FMOMHUKBSA-N |
| XLogP | 6.69 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.21 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|