About ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole
ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 142911826) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| PubChem CID | 142911826 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC.Cc1cnc2n1CCS2 |
| InChI | InChI=1S/C6H8N2S.C2H6/c1-5-4-7-6-8(5)2-3-9-6;1-2/h4H,2-3H2,1H3;1-2H3 |
| InChIKey | HNCYITLTFRHDSJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole (CID 142911826) is ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole is CC.Cc1cnc2n1CCS2.
What is the InChIKey of ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The InChIKey is HNCYITLTFRHDSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S.C2H6/c1-5-4-7-6-8(5)2-3-9-6;1-2/h4H,2-3H2,1H3;1-2H3.
What are the key properties of ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole has a molecular weight of 170.28 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 142911826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).