C15H32N4O — CID 142912090
ethane;2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide;hydrate (PubChem CID 142912090) has the molecular formula C15H32N4O and a molecular weight of 284.45 g/mol. Its IUPAC name is ethane;2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide;hydrate.
| Compound Name | ethane;2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide;hydrate |
|---|---|
| PubChem CID | 142912090 |
| Molecular Formula | C15H32N4O |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | ethane;2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide;hydrate |
| SMILES | CC.O.[H]/N=C(\N)CN1CCN(/C(C)=C/C=C\CC)CC1 |
| InChI | InChI=1S/C13H24N4.C2H6.H2O/c1-3-4-5-6-12(2)17-9-7-16(8-10-17)11-13(14)15;1-2;/h4-6H,3,7-11H2,1-2H3,(H3,14,15);1-2H3;1H2/b5-4-,12-6+;; |
| InChIKey | LCELOJAIIOEFGP-LFYHMVHESA-N |
| XLogP | 1.61 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|