About but-1-ene;2-methylbut-1-en-3-yne;propane
but-1-ene;2-methylbut-1-en-3-yne;propane (PubChem CID 142912190) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is but-1-ene;2-methylbut-1-en-3-yne;propane.
Molecular Properties
| Compound Name | but-1-ene;2-methylbut-1-en-3-yne;propane |
| PubChem CID | 142912190 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | but-1-ene;2-methylbut-1-en-3-yne;propane |
| SMILES | C#CC(=C)C.C=CCC.CCC |
| InChI | InChI=1S/C5H6.C4H8.C3H8/c1-4-5(2)3;1-3-4-2;1-3-2/h1H,2H2,3H3;3H,1,4H2,2H3;3H2,1-2H3 |
| InChIKey | FJHQYIRAYKVEDH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;2-methylbut-1-en-3-yne;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;2-methylbut-1-en-3-yne;propane?
The IUPAC name of but-1-ene;2-methylbut-1-en-3-yne;propane (CID 142912190) is but-1-ene;2-methylbut-1-en-3-yne;propane.
What is the SMILES notation for but-1-ene;2-methylbut-1-en-3-yne;propane?
The canonical SMILES for but-1-ene;2-methylbut-1-en-3-yne;propane is C#CC(=C)C.C=CCC.CCC.
What is the InChIKey of but-1-ene;2-methylbut-1-en-3-yne;propane?
The InChIKey is FJHQYIRAYKVEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6.C4H8.C3H8/c1-4-5(2)3;1-3-4-2;1-3-2/h1H,2H2,3H3;3H,1,4H2,2H3;3H2,1-2H3.
What are the key properties of but-1-ene;2-methylbut-1-en-3-yne;propane?
but-1-ene;2-methylbut-1-en-3-yne;propane has a molecular weight of 166.31 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;2-methylbut-1-en-3-yne;propane is sourced from PubChem (CID 142912190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).