About 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene
1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene (PubChem CID 142912558) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene |
| PubChem CID | 142912558 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene |
| SMILES | CCC(C)(CC)C1=CC=C(C(C)(C)C)CC=C1 |
| InChI | InChI=1S/C17H28/c1-7-17(6,8-2)15-11-9-10-14(12-13-15)16(3,4)5/h9,11-13H,7-8,10H2,1-6H3 |
| InChIKey | GTPFHYGGIJYWNX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene?
The IUPAC name of 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene (CID 142912558) is 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene.
What is the SMILES notation for 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene?
The canonical SMILES for 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene is CCC(C)(CC)C1=CC=C(C(C)(C)C)CC=C1.
What is the InChIKey of 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene?
The InChIKey is GTPFHYGGIJYWNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-7-17(6,8-2)15-11-9-10-14(12-13-15)16(3,4)5/h9,11-13H,7-8,10H2,1-6H3.
What are the key properties of 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene?
1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene has a molecular weight of 232.41 g/mol, XLogP of 5.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(3-methylpentan-3-yl)cyclohepta-1,3,5-triene is sourced from PubChem (CID 142912558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).