C19H17F3N4O3 — CID 142912702
[N'-(2,3-dihydroxypropyl)carbamimidoyl] 2-(4-ethynyl-2-fluoroanilino)-3,4-difluorobenzenecarboximidate (PubChem CID 142912702) has the molecular formula C19H17F3N4O3 and a molecular weight of 406.36 g/mol. Its IUPAC name is [N'-(2,3-dihydroxypropyl)carbamimidoyl] 2-(4-ethynyl-2-fluoroanilino)-3,4-difluorobenzenecarboximidate.
| Compound Name | [N'-(2,3-dihydroxypropyl)carbamimidoyl] 2-(4-ethynyl-2-fluoroanilino)-3,4-difluorobenzenecarboximidate |
|---|---|
| PubChem CID | 142912702 |
| Molecular Formula | C19H17F3N4O3 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [N'-(2,3-dihydroxypropyl)carbamimidoyl] 2-(4-ethynyl-2-fluoroanilino)-3,4-difluorobenzenecarboximidate |
| SMILES | [H]/N=C(\O/C(N)=N/CC(O)CO)c1ccc(F)c(F)c1Nc1ccc(C#C)cc1F |
| InChI | InChI=1S/C19H17F3N4O3/c1-2-10-3-6-15(14(21)7-10)26-17-12(4-5-13(20)16(17)22)18(23)29-19(24)25-8-11(28)9-27/h1,3-7,11,23,26-28H,8-9H2,(H2,24,25)/b23-18- |
| InChIKey | VLCDZGTWVRBQFP-NKFKGCMQSA-N |
| XLogP | 1.84 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|