C11H18FN — CID 142913317
N-[(3E,7Z)-6-fluorodeca-3,7-dien-2-yl]methanimine (PubChem CID 142913317) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is N-[(3E,7Z)-6-fluorodeca-3,7-dien-2-yl]methanimine.
| Compound Name | N-[(3E,7Z)-6-fluorodeca-3,7-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 142913317 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N-[(3E,7Z)-6-fluorodeca-3,7-dien-2-yl]methanimine |
| SMILES | C=NC(C)/C=C/CC(F)/C=C\CC |
| InChI | InChI=1S/C11H18FN/c1-4-5-8-11(12)9-6-7-10(2)13-3/h5-8,10-11H,3-4,9H2,1-2H3/b7-6+,8-5- |
| InChIKey | SHZUDPXUKLDNKP-NGWHPUCNSA-N |
| XLogP | 3.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|