C10H14FN — CID 142913457
N-[1-(2-fluorocyclohexa-1,5-dien-1-yl)ethyl]ethanimine (PubChem CID 142913457) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is N-[1-(2-fluorocyclohexa-1,5-dien-1-yl)ethyl]ethanimine.
| Compound Name | N-[1-(2-fluorocyclohexa-1,5-dien-1-yl)ethyl]ethanimine |
|---|---|
| PubChem CID | 142913457 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-[1-(2-fluorocyclohexa-1,5-dien-1-yl)ethyl]ethanimine |
| SMILES | C/C=N/C(C)C1=C(F)CCC=C1 |
| InChI | InChI=1S/C10H14FN/c1-3-12-8(2)9-6-4-5-7-10(9)11/h3-4,6,8H,5,7H2,1-2H3/b12-3+ |
| InChIKey | SEHDGAPOKADZDJ-KGVSQERTSA-N |
| XLogP | 3.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|