About tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate
tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate (PubChem CID 142913917) has the molecular formula C17H29N3O7
and a molecular weight of 387.43 g/mol. Its IUPAC name is tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
| PubChem CID | 142913917 |
| Molecular Formula | C17H29N3O7 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate |
| SMILES | CC(CCCCO)NC(=O)OC(C)(C)C.COC(=O)c1nc[nH]c(=O)c1O |
| InChI | InChI=1S/C11H23NO3.C6H6N2O4/c1-9(7-5-6-8-13)12-10(14)15-11(2,3)4;1-12-6(11)3-4(9)5(10)8-2-7-3/h9,13H,5-8H2,1-4H3,(H,12,14);2,9H,1H3,(H,7,8,10) |
| InChIKey | OURAXBMSIWLJRT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
The IUPAC name of tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate (CID 142913917) is tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate.
What is the SMILES notation for tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
The canonical SMILES for tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate is CC(CCCCO)NC(=O)OC(C)(C)C.COC(=O)c1nc[nH]c(=O)c1O.
What is the InChIKey of tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
The InChIKey is OURAXBMSIWLJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3.C6H6N2O4/c1-9(7-5-6-8-13)12-10(14)15-11(2,3)4;1-12-6(11)3-4(9)5(10)8-2-7-3/h9,13H,5-8H2,1-4H3,(H,12,14);2,9H,1H3,(H,7,8,10).
What are the key properties of tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate?
tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate has a molecular weight of 387.43 g/mol, XLogP of 1.32, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(6-hydroxyhexan-2-yl)carbamate;methyl 5-hydroxy-6-oxo-1H-pyrimidine-4-carboxylate is sourced from PubChem (CID 142913917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).