C9H11NO3 — CID 142914080
methyl (2Z)-2-ethenyl-3-(oxaziridin-2-yl)penta-2,4-dienoate (PubChem CID 142914080) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is methyl (2Z)-2-ethenyl-3-(oxaziridin-2-yl)penta-2,4-dienoate.
| Compound Name | methyl (2Z)-2-ethenyl-3-(oxaziridin-2-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 142914080 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | methyl (2Z)-2-ethenyl-3-(oxaziridin-2-yl)penta-2,4-dienoate |
| SMILES | C=C/C(C(=O)OC)=C(\C=C)N1CO1 |
| InChI | InChI=1S/C9H11NO3/c1-4-7(9(11)12-3)8(5-2)10-6-13-10/h4-5H,1-2,6H2,3H3/b8-7- |
| InChIKey | IFLXGSCETVPBGP-FPLPWBNLSA-N |
| XLogP | 0.99 |
| TPSA | 41.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|