About 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane
1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane (PubChem CID 142914280) has the molecular formula C11H13F3O
and a molecular weight of 218.22 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane.
Molecular Properties
| Compound Name | 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane |
| PubChem CID | 142914280 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane |
| SMILES | CC(=O)Cc1cccc(C(F)F)c1.CF |
| InChI | InChI=1S/C10H10F2O.CH3F/c1-7(13)5-8-3-2-4-9(6-8)10(11)12;1-2/h2-4,6,10H,5H2,1H3;1H3 |
| InChIKey | ACTJYCXPPFQZMF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane?
The IUPAC name of 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane (CID 142914280) is 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane.
What is the SMILES notation for 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane?
The canonical SMILES for 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane is CC(=O)Cc1cccc(C(F)F)c1.CF.
What is the InChIKey of 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane?
The InChIKey is ACTJYCXPPFQZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O.CH3F/c1-7(13)5-8-3-2-4-9(6-8)10(11)12;1-2/h2-4,6,10H,5H2,1H3;1H3.
What are the key properties of 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane?
1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane has a molecular weight of 218.22 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(difluoromethyl)phenyl]propan-2-one;fluoromethane is sourced from PubChem (CID 142914280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).