C17H28O2 — CID 142914652
2-(4-methylcyclohexyl)-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-6-ol (PubChem CID 142914652) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-(4-methylcyclohexyl)-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-6-ol.
| Compound Name | 2-(4-methylcyclohexyl)-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-6-ol |
|---|---|
| PubChem CID | 142914652 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-(4-methylcyclohexyl)-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-6-ol |
| SMILES | CC1CCC(C2CC3CCC(O)CC3C3OC23)CC1 |
| InChI | InChI=1S/C17H28O2/c1-10-2-4-11(5-3-10)14-8-12-6-7-13(18)9-15(12)17-16(14)19-17/h10-18H,2-9H2,1H3 |
| InChIKey | PJOZLWFQPISJLZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|