About 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine
5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine (PubChem CID 142914783) has the molecular formula C9H10OS
and a molecular weight of 166.24 g/mol. Its IUPAC name is 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine.
Molecular Properties
| Compound Name | 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine |
| PubChem CID | 142914783 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine |
| SMILES | C#CC1=C(C(=C)C)OCCS1 |
| InChI | InChI=1S/C9H10OS/c1-4-8-9(7(2)3)10-5-6-11-8/h1H,2,5-6H2,3H3 |
| InChIKey | WKCYKTZCXXJBEM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine?
The IUPAC name of 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine (CID 142914783) is 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine.
What is the SMILES notation for 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine?
The canonical SMILES for 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine is C#CC1=C(C(=C)C)OCCS1.
What is the InChIKey of 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine?
The InChIKey is WKCYKTZCXXJBEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-4-8-9(7(2)3)10-5-6-11-8/h1H,2,5-6H2,3H3.
What are the key properties of 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine?
5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine has a molecular weight of 166.24 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethynyl-6-prop-1-en-2-yl-2,3-dihydro-1,4-oxathiine is sourced from PubChem (CID 142914783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).