About 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde
5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde (PubChem CID 142914993) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde |
| PubChem CID | 142914993 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde |
| SMILES | CCC(C)(COC1=CCC=C(C=O)C=C1)N(C)C |
| InChI | InChI=1S/C15H23NO2/c1-5-15(2,16(3)4)12-18-14-8-6-7-13(11-17)9-10-14/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | JZMHRIWLRVTDMV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde?
The IUPAC name of 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde (CID 142914993) is 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde.
What is the SMILES notation for 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde?
The canonical SMILES for 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde is CCC(C)(COC1=CCC=C(C=O)C=C1)N(C)C.
What is the InChIKey of 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde?
The InChIKey is JZMHRIWLRVTDMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-5-15(2,16(3)4)12-18-14-8-6-7-13(11-17)9-10-14/h7-11H,5-6,12H2,1-4H3.
What are the key properties of 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde?
5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde has a molecular weight of 249.35 g/mol, XLogP of 2.70, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(dimethylamino)-2-methylbutoxy]cyclohepta-1,4,6-triene-1-carbaldehyde is sourced from PubChem (CID 142914993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).