C29H39NO6 — CID 142915256
acetylene;ethyl 2-(3,4-dimethoxyanilino)acetate;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate (PubChem CID 142915256) has the molecular formula C29H39NO6 and a molecular weight of 497.63 g/mol. Its IUPAC name is acetylene;ethyl 2-(3,4-dimethoxyanilino)acetate;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate.
| Compound Name | acetylene;ethyl 2-(3,4-dimethoxyanilino)acetate;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 142915256 |
| Molecular Formula | C29H39NO6 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | acetylene;ethyl 2-(3,4-dimethoxyanilino)acetate;5,6,7,8-tetrahydronaphthalen-2-yl 2,2-dimethylpropanoate |
| SMILES | C#C.CC(C)(C)C(=O)Oc1ccc2c(c1)CCCC2.CCOC(=O)CNc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20O2.C12H17NO4.C2H2/c1-15(2,3)14(16)17-13-9-8-11-6-4-5-7-12(11)10-13;1-4-17-12(14)8-13-9-5-6-10(15-2)11(7-9)16-3;1-2/h8-10H,4-7H2,1-3H3;5-7,13H,4,8H2,1-3H3;1-2H |
| InChIKey | KNLNOZGWDQXLEW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|