About ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide
ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide (PubChem CID 142915706) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide.
Molecular Properties
| Compound Name | ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide |
| PubChem CID | 142915706 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide |
| SMILES | C=C/C(C)=C\N=C\N.CC |
| InChI | InChI=1S/C6H10N2.C2H6/c1-3-6(2)4-8-5-7;1-2/h3-5H,1H2,2H3,(H2,7,8);1-2H3/b6-4-; |
| InChIKey | OZATZELNXRJWDD-YHSAGPEESA-N |
| XLogP | 2.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide?
The IUPAC name of ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide (CID 142915706) is ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide.
What is the SMILES notation for ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide?
The canonical SMILES for ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide is C=C/C(C)=C\N=C\N.CC.
What is the InChIKey of ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide?
The InChIKey is OZATZELNXRJWDD-YHSAGPEESA-N. The full InChI is InChI=1S/C6H10N2.C2H6/c1-3-6(2)4-8-5-7;1-2/h3-5H,1H2,2H3,(H2,7,8);1-2H3/b6-4-;.
What are the key properties of ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide?
ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide has a molecular weight of 140.23 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N'-[(1Z)-2-methylbuta-1,3-dienyl]methanimidamide is sourced from PubChem (CID 142915706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).