About 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane
8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane (PubChem CID 142916182) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane |
| PubChem CID | 142916182 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane |
| SMILES | C=C(/C=C\C=C/C)CC1COC2(CCN(C)CC2)C1 |
| InChI | InChI=1S/C17H27NO/c1-4-5-6-7-15(2)12-16-13-17(19-14-16)8-10-18(3)11-9-17/h4-7,16H,2,8-14H2,1,3H3/b5-4-,7-6- |
| InChIKey | VMZWLGJTVGYSHT-RZSVFLSASA-N |
| XLogP | 3.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane?
The IUPAC name of 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane (CID 142916182) is 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane.
What is the SMILES notation for 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane?
The canonical SMILES for 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane is C=C(/C=C\C=C/C)CC1COC2(CCN(C)CC2)C1.
What is the InChIKey of 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane?
The InChIKey is VMZWLGJTVGYSHT-RZSVFLSASA-N. The full InChI is InChI=1S/C17H27NO/c1-4-5-6-7-15(2)12-16-13-17(19-14-16)8-10-18(3)11-9-17/h4-7,16H,2,8-14H2,1,3H3/b5-4-,7-6-.
What are the key properties of 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane?
8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane has a molecular weight of 261.41 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-1-oxa-8-azaspiro[4.5]decane is sourced from PubChem (CID 142916182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).