C18H29NO — CID 142916212
8-methyl-3-[(3Z,6Z)-nona-3,6,8-trienyl]-1-oxa-8-azaspiro[4.5]decane (PubChem CID 142916212) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 8-methyl-3-[(3Z,6Z)-nona-3,6,8-trienyl]-1-oxa-8-azaspiro[4.5]decane.
| Compound Name | 8-methyl-3-[(3Z,6Z)-nona-3,6,8-trienyl]-1-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 142916212 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 8-methyl-3-[(3Z,6Z)-nona-3,6,8-trienyl]-1-oxa-8-azaspiro[4.5]decane |
| SMILES | C=C/C=C\C/C=C\CCC1COC2(CCN(C)CC2)C1 |
| InChI | InChI=1S/C18H29NO/c1-3-4-5-6-7-8-9-10-17-15-18(20-16-17)11-13-19(2)14-12-18/h3-5,7-8,17H,1,6,9-16H2,2H3/b5-4-,8-7- |
| InChIKey | LGNSRIUBQZXYFN-UTOQUPLUSA-N |
| XLogP | 3.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|