About 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid
6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 142916250) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 142916250 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1C=C(C(=O)O)C(C2=C3C=CC(N)C=C3Oc3cc(N)ccc32)=CC1 |
| InChI | InChI=1S/C21H20N2O3/c1-11-2-5-14(17(8-11)21(24)25)20-15-6-3-12(22)9-18(15)26-19-10-13(23)4-7-16(19)20/h3-12H,2,22-23H2,1H3,(H,24,25) |
| InChIKey | WGSALJSLKMFIFS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid (CID 142916250) is 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid is CC1C=C(C(=O)O)C(C2=C3C=CC(N)C=C3Oc3cc(N)ccc32)=CC1.
What is the InChIKey of 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is WGSALJSLKMFIFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-11-2-5-14(17(8-11)21(24)25)20-15-6-3-12(22)9-18(15)26-19-10-13(23)4-7-16(19)20/h3-12H,2,22-23H2,1H3,(H,24,25).
What are the key properties of 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid?
6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 348.40 g/mol, XLogP of 3.17, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,6-diamino-3H-xanthen-9-yl)-3-methylcyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 142916250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).