C25H27ClN4O2 — CID 142916859
2-[2-[(E)-2-(6-chloro-4-methyl-2-morpholin-4-ylcyclohexa-1,5-dien-1-yl)ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 142916859) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is 2-[2-[(E)-2-(6-chloro-4-methyl-2-morpholin-4-ylcyclohexa-1,5-dien-1-yl)ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-[(E)-2-(6-chloro-4-methyl-2-morpholin-4-ylcyclohexa-1,5-dien-1-yl)ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 142916859 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[2-[(E)-2-(6-chloro-4-methyl-2-morpholin-4-ylcyclohexa-1,5-dien-1-yl)ethenyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | CC1C=C(Cl)C(/C=C/c2cc(-c3cc4c([nH]3)CCNC4=O)ccn2)=C(N2CCOCC2)C1 |
| InChI | InChI=1S/C25H27ClN4O2/c1-16-12-21(26)19(24(13-16)30-8-10-32-11-9-30)3-2-18-14-17(4-6-27-18)23-15-20-22(29-23)5-7-28-25(20)31/h2-4,6,12,14-16,29H,5,7-11,13H2,1H3,(H,28,31)/b3-2+ |
| InChIKey | PMGCKYDAHAAJTG-NSCUHMNNSA-N |
| XLogP | 4.12 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |