C18H14F2N3OP — CID 142917082
2-[2-(3,4-difluoro-5-phosphanylphenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 142917082) has the molecular formula C18H14F2N3OP and a molecular weight of 357.30 g/mol. Its IUPAC name is 2-[2-(3,4-difluoro-5-phosphanylphenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-(3,4-difluoro-5-phosphanylphenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 142917082 |
| Molecular Formula | C18H14F2N3OP |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[2-(3,4-difluoro-5-phosphanylphenyl)-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2[nH]c(-c3ccnc(-c4cc(F)c(F)c(P)c4)c3)cc21 |
| InChI | InChI=1S/C18H14F2N3OP/c19-12-5-10(7-16(25)17(12)20)14-6-9(1-3-21-14)15-8-11-13(23-15)2-4-22-18(11)24/h1,3,5-8,23H,2,4,25H2,(H,22,24) |
| InChIKey | NDZWXXGYNJBLHY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|